Benzenesulfonamide, N-(3-chloro-1H-inden-2-yl)-
CAS No: 88576-70-9
Inden
88576-70-9
benzenesulfonamide,chloro,inden,88576-70-9
2025-10-17 Discover Benzenesulfonamide, N-(3-chloro-1H-inden-2-yl)- (CAS No: 88576-70-9) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.